ChemNet > CAS > 1592-31-0 1,4-bis(dibromomethyl)benzene
1592-31-0 1,4-bis(dibromomethyl)benzene
| Ονομασία του προϊόντος |
1,4-bis(dibromomethyl)benzene |
| Συνώνυμα |
Tetrabromoxylene; 1,4-Di(dibromomethyl)benzene; alpha,alpha,alphaalpha-Tetrabromo-p-xylene |
| MF |
C8H6Br4 |
| Μοριακό βάρος |
421.7492 |
| InChI |
InChI=1/C8H6Br4/c9-7(10)5-1-2-6(4-3-5)8(11)12/h1-4,7-8H |
| CAS ΟΧΙ |
1592-31-0 |
| EINECS |
216-473-3 |
| Μοριακή δομή |
|
| Πυκνότητα |
2.392g/cm3 |
| Σημείο τήξης |
170℃ |
| Σημείο βρασμού |
351.9°C at 760 mmHg |
| Δείκτης διάθλασης |
1.685 |
| Σημείο ανάφλεξης |
162.3°C |
| Σύμβολα επικινδυνότητας |
 T:Toxic;
|
| Κινδύνου Κώδικες |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28A:After contact with skin, wash immediately with plenty of water.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S38:In case of insufficient ventilation, wear suitable respiratory equipment.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
