ChemNet > CAS > 170230-87-2 4-Amino-3-ethylbenzonitrile
170230-87-2 4-Amino-3-ethylbenzonitrile
Ονομασία του προϊόντος |
4-Amino-3-ethylbenzonitrile |
Συνώνυμα |
4-Cyano-2-ethylaniline |
MF |
C9H10N2 |
Μοριακό βάρος |
146.1891 |
InChI |
InChI=1/C9H10N2/c1-2-8-5-7(6-10)3-4-9(8)11/h3-5H,2,11H2,1H3 |
CAS ΟΧΙ |
170230-87-2 |
Μοριακή δομή |
|
Πυκνότητα |
1.07g/cm3 |
Σημείο βρασμού |
297.1°C at 760 mmHg |
Δείκτης διάθλασης |
1.562 |
Σημείο ανάφλεξης |
133.5°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Περιγραφή της ασφάλειας |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|