ChemNet > CAS > 170572-49-3 3-Fluoro-4-methylbenzonitrile
170572-49-3 3-Fluoro-4-methylbenzonitrile
| Ονομασία του προϊόντος |
3-Fluoro-4-methylbenzonitrile |
| Συνώνυμα |
4-Cyano-2-fluorotoluene; 3-Fluoro-p-tolunitrile |
| MF |
C8H6FN |
| Μοριακό βάρος |
135.1383 |
| InChI |
InChI=1/C8H6FN/c1-6-2-3-7(5-10)4-8(6)9/h2-4H,1H3 |
| CAS ΟΧΙ |
170572-49-3 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.117g/cm3 |
| Σημείο τήξης |
48-50℃ |
| Σημείο βρασμού |
215.069°C at 760 mmHg |
| Δείκτης διάθλασης |
1.508 |
| Σημείο ανάφλεξης |
90.3°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Περιγραφή της ασφάλειας |
S36/37:Wear suitable protective clothing and gloves.;
|
|
