ChemNet > CAS > 175135-63-4 3-amino-2-(2,4-difluorophenoxy)pyridine
175135-63-4 3-amino-2-(2,4-difluorophenoxy)pyridine
| Ονομασία του προϊόντος |
3-amino-2-(2,4-difluorophenoxy)pyridine |
| Συνώνυμα |
2-(2,4-Difluorophenoxy)pyridin-3-amine; 2-(4-fluorophenoxy)pyridin-3-amine |
| MF |
C11H9FN2O |
| Μοριακό βάρος |
204.2004 |
| InChI |
InChI=1/C11H9FN2O/c12-8-3-5-9(6-4-8)15-11-10(13)2-1-7-14-11/h1-7H,13H2 |
| CAS ΟΧΙ |
175135-63-4 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.278g/cm3 |
| Σημείο τήξης |
95-96℃ |
| Σημείο βρασμού |
328.8°C at 760 mmHg |
| Δείκτης διάθλασης |
1.605 |
| Σημείο ανάφλεξης |
152.7°C |
| Σύμβολα επικινδυνότητας |
 Xi:Irritant;
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
