ChemNet > CAS > 175136-87-5 N-(5-bromo-4-methyl-1,3-thiazol-2-yl)guanidine
175136-87-5 N-(5-bromo-4-methyl-1,3-thiazol-2-yl)guanidine
| Ονομασία του προϊόντος |
N-(5-bromo-4-methyl-1,3-thiazol-2-yl)guanidine |
| Συνώνυμα |
2-(5-bromo-4-methyl-1,3-thiazol-2-yl)guanidine |
| MF |
C5H7BrN4S |
| Μοριακό βάρος |
235.1049 |
| InChI |
InChI=1/C5H7BrN4S/c1-2-3(6)11-5(9-2)10-4(7)8/h1H3,(H4,7,8,9,10) |
| CAS ΟΧΙ |
175136-87-5 |
| Μοριακή δομή |
|
| Πυκνότητα |
2.06g/cm3 |
| Σημείο τήξης |
203℃ |
| Σημείο βρασμού |
402°C at 760 mmHg |
| Δείκτης διάθλασης |
1.79 |
| Σημείο ανάφλεξης |
196.9°C |
| Σύμβολα επικινδυνότητας |
 Xi:Irritant;
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
