ChemNet > CAS > 175203-52-8 1,4-dimethylpiperazine-2-carbohydrazide
175203-52-8 1,4-dimethylpiperazine-2-carbohydrazide
| Ονομασία του προϊόντος |
1,4-dimethylpiperazine-2-carbohydrazide |
| MF |
C7H16N4O |
| Μοριακό βάρος |
172.2281 |
| InChI |
InChI=1/C7H16N4O/c1-10-3-4-11(2)6(5-10)7(12)9-8/h6H,3-5,8H2,1-2H3,(H,9,12) |
| CAS ΟΧΙ |
175203-52-8 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.105g/cm3 |
| Σημείο τήξης |
105℃ |
| Σημείο βρασμού |
339.7°C at 760 mmHg |
| Δείκτης διάθλασης |
1.511 |
| Σημείο ανάφλεξης |
159.2°C |
| Σύμβολα επικινδυνότητας |
 C:Corrosive;
|
| Κινδύνου Κώδικες |
R34:Causes burns.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
