ChemNet > CAS > 175204-69-0 4-hydrazino-6-(2-pyridyl)-1,3,5-triazin-2-amine
175204-69-0 4-hydrazino-6-(2-pyridyl)-1,3,5-triazin-2-amine
| Ονομασία του προϊόντος |
4-hydrazino-6-(2-pyridyl)-1,3,5-triazin-2-amine |
| Συνώνυμα |
4-hydrazinyl-6-(pyridin-2-yl)-1,3,5-triazin-2-amine |
| MF |
C8H9N7 |
| Μοριακό βάρος |
203.204 |
| InChI |
InChI=1/C8H9N7/c9-7-12-6(13-8(14-7)15-10)5-3-1-2-4-11-5/h1-4H,10H2,(H3,9,12,13,14,15) |
| CAS ΟΧΙ |
175204-69-0 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.488g/cm3 |
| Σημείο τήξης |
287℃ |
| Σημείο βρασμού |
550.8°C at 760 mmHg |
| Δείκτης διάθλασης |
1.756 |
| Σημείο ανάφλεξης |
286.9°C |
| Σύμβολα επικινδυνότητας |
 Xn:Harmful;
|
| Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
