ChemNet > CAS > 17530-69-7 3-Chloro-5,5-dimethyl-2-cyclohexen-1-one
17530-69-7 3-Chloro-5,5-dimethyl-2-cyclohexen-1-one
| Ονομασία του προϊόντος |
3-Chloro-5,5-dimethyl-2-cyclohexen-1-one |
| Συνώνυμα |
3-Chloro-5,5-dimethylcyclohex-2-enone; 3-chloro-5,5-dimethylcyclohex-2-en-1-one |
| MF |
C8H11ClO |
| Μοριακό βάρος |
158.6253 |
| InChI |
InChI=1/C8H11ClO/c1-8(2)4-6(9)3-7(10)5-8/h3H,4-5H2,1-2H3 |
| CAS ΟΧΙ |
17530-69-7 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.09g/cm3 |
| Σημείο βρασμού |
217.7°C at 760 mmHg |
| Δείκτης διάθλασης |
1.488 |
| Σημείο ανάφλεξης |
104.8°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R36/38:Irritating to eyes and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
