ChemNet > CAS > 18536-91-9 Dodecyltriethoxysilane
18536-91-9 Dodecyltriethoxysilane
| Ονομασία του προϊόντος |
Dodecyltriethoxysilane |
| Συνώνυμα |
n-Dodecyltriethoxysilane; n-Diethoxytrethoxysilane; hexadecane-2,15-dione |
| MF |
C16H30O2 |
| Μοριακό βάρος |
254.4082 |
| InChI |
InChI=1/C16H30O2/c1-15(17)13-11-9-7-5-3-4-6-8-10-12-14-16(2)18/h3-14H2,1-2H3 |
| CAS ΟΧΙ |
18536-91-9 |
| EINECS |
242-409-9 |
| Μοριακή δομή |
|
| Πυκνότητα |
0.886g/cm3 |
| Σημείο βρασμού |
353.1°C at 760 mmHg |
| Δείκτης διάθλασης |
1.444 |
| Σημείο ανάφλεξης |
132.5°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R36/38:Irritating to eyes and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
