ChemNet > CAS > 18917-76-5 1,3-dimethoxy-5-(2-nitroprop-1-enyl)benzene
18917-76-5 1,3-dimethoxy-5-(2-nitroprop-1-enyl)benzene
Ονομασία του προϊόντος |
1,3-dimethoxy-5-(2-nitroprop-1-enyl)benzene |
Συνώνυμα |
1-(3,5-Dimethoxyphenyl)-2-nitroprop-1-ene; 1,3-dimethoxy-5-(2-nitroprop-1-en-1-yl)benzene |
MF |
C11H13NO4 |
Μοριακό βάρος |
223.2252 |
InChI |
InChI=1/C11H13NO4/c1-8(12(13)14)4-9-5-10(15-2)7-11(6-9)16-3/h4-7H,1-3H3 |
CAS ΟΧΙ |
18917-76-5 |
Μοριακή δομή |
|
Πυκνότητα |
1.168g/cm3 |
Σημείο τήξης |
87℃ |
Σημείο βρασμού |
358°C at 760 mmHg |
Δείκτης διάθλασης |
1.555 |
Σημείο ανάφλεξης |
159.4°C |
Σύμβολα επικινδυνότητας |
Xi:Irritant;
|
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|