ChemNet > CAS > 1892-43-9 2-(4-Chlorophenoxy)ethanol
1892-43-9 2-(4-Chlorophenoxy)ethanol
| Ονομασία του προϊόντος |
2-(4-Chlorophenoxy)ethanol |
| Συνώνυμα |
Ethanol, 2-(4-chlorophenoxy)-; 2-(4'-Chlorfenoxy)ethanol; 2-(4'-Chlorfenoxy)ethanol [Czech]; 2-(p-Chlorophenoxy)ethanol; 4-06-00-00826 (Beilstein Handbook Reference); AI3-02225; BRN 1365684; Chloro-p-phenoxetol; Chlorophetanol; NSC 8133; p-Chlorfenylmonoglykolether; p-Chlorfenylmonoglykolether [Czech]; p-Chlorophenyl 2-hydroxyethyl ether; p-Chlorophenyl glycol ether; p-Chlorophenyl monoglycol ether; Ethanol, 2-(p-chlorophenoxy)- |
| MF |
C8H9ClO2 |
| Μοριακό βάρος |
172.6089 |
| InChI |
InChI=1/C8H9ClO2/c9-7-1-3-8(4-2-7)11-6-5-10/h1-4,10H,5-6H2 |
| CAS ΟΧΙ |
1892-43-9 |
| EINECS |
217-578-7 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.238g/cm3 |
| Σημείο βρασμού |
279.7°C at 760 mmHg |
| Δείκτης διάθλασης |
1.543 |
| Σημείο ανάφλεξης |
123°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R21/22:Harmful in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| Περιγραφή της ασφάλειας |
S22:Do not inhale dust.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
