ChemNet > CAS > 19056-40-7 4-Bromo-3-methoxyaniline
19056-40-7 4-Bromo-3-methoxyaniline
| Ονομασία του προϊόντος |
4-Bromo-3-methoxyaniline |
| Συνώνυμα |
4-Bromo-m-anisidine; 4-nitrophenyl 2-aminobenzoate; 4-Bromo-3-Methoxy-Phenylamine |
| MF |
C13H10N2O4 |
| Μοριακό βάρος |
258.2295 |
| InChI |
InChI=1/C13H10N2O4/c14-12-4-2-1-3-11(12)13(16)19-10-7-5-9(6-8-10)15(17)18/h1-8H,14H2 |
| CAS ΟΧΙ |
19056-40-7 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.381g/cm3 |
| Σημείο βρασμού |
467°C at 760 mmHg |
| Δείκτης διάθλασης |
1.655 |
| Σημείο ανάφλεξης |
236.2°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Περιγραφή της ασφάλειας |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
