ChemNet > CAS > 202865-73-4 2-Bromo-4-fluoro-1-iodobenzene
202865-73-4 2-Bromo-4-fluoro-1-iodobenzene
| Ονομασία του προϊόντος |
2-Bromo-4-fluoro-1-iodobenzene |
| Συνώνυμα |
2-Bromo-4-fluoroiodobenzene |
| MF |
C6H3BrFI |
| Μοριακό βάρος |
300.8949 |
| InChI |
InChI=1/C6H3BrFI/c7-5-3-4(8)1-2-6(5)9/h1-3H |
| CAS ΟΧΙ |
202865-73-4 |
| Μοριακή δομή |
|
| Πυκνότητα |
2.281g/cm3 |
| Σημείο βρασμού |
243.2°C at 760 mmHg |
| Δείκτης διάθλασης |
1.628 |
| Σημείο ανάφλεξης |
100.9°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
