CAS No: 2049-55-0, Chemical Name: Borane-triphenylphosphine complex
Chemical CAS Database with Global Chemical Suppliers - ChemNet
the physical and chemical property of 2049-55-0, Borane-triphenylphosphine complex is provided by ChemNet.com

  ChemNet > CAS > 2049-55-0 Borane-triphenylphosphine complex

2049-55-0 Borane-triphenylphosphine complex

Ονομασία του προϊόντος Borane-triphenylphosphine complex
Συνώνυμα Borane-triphenylphosphine (1:1); borane, compd. with triphenylphosphine (1:1); borane-triphenylphosphane (1:1); Borane-Trimethylamine; Triphenylphosphine borane; Borane-Triphenylphosphine; Borane triphenylphosphine complex
MF C18H18BP
Μοριακό βάρος 276.1203
InChI InChI=1/C18H15P.BH3/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h1-15H;1H3
CAS ΟΧΙ 2049-55-0
Μοριακή δομή 2049-55-0 Borane-triphenylphosphine complex
Σημείο βρασμού 360°C at 760 mmHg
Σημείο ανάφλεξης 181.7°C
Σύμβολα επικινδυνότητας
Κινδύνου Κώδικες
Περιγραφή της ασφάλειας