ChemNet > CAS > 2058-74-4 1-Methylisatin
2058-74-4 1-Methylisatin
| Ονομασία του προϊόντος |
1-Methylisatin |
| Συνώνυμα |
Methylisatintech; 1-methyl-2,3-dihydroindole-2,3-dione; N-Methylsatin; 1-Methyl-2,3-indolinedione; 1-methyl-1H-indole-2,3-dione; 1-Methylindoline-2,3-Dione |
| MF |
C9H7NO2 |
| Μοριακό βάρος |
161.1574 |
| InChI |
InChI=1/C9H7NO2/c1-10-7-5-3-2-4-6(7)8(11)9(10)12/h2-5H,1H3 |
| CAS ΟΧΙ |
2058-74-4 |
| EINECS |
218-164-9 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.314g/cm3 |
| Σημείο τήξης |
129-133℃ |
| Σημείο βρασμού |
294.3°C at 760 mmHg |
| Δείκτης διάθλασης |
1.607 |
| Σημείο ανάφλεξης |
137.4°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
|
| Περιγραφή της ασφάλειας |
S24/25:Avoid contact with skin and eyes.;
|
|
