ChemNet > CAS > 214894-89-0 5-(Bromomethyl)-2,3-dihydro-1,4-benzodioxine
214894-89-0 5-(Bromomethyl)-2,3-dihydro-1,4-benzodioxine
Ονομασία του προϊόντος |
5-(Bromomethyl)-2,3-dihydro-1,4-benzodioxine |
Συνώνυμα |
8-(bromomethyl)-2,3-dihydro-1,4-benzodioxine |
MF |
C9H9BrO2 |
Μοριακό βάρος |
229.0706 |
InChI |
InChI=1/C9H9BrO2/c10-6-7-2-1-3-8-9(7)12-5-4-11-8/h1-3H,4-6H2 |
CAS ΟΧΙ |
214894-89-0 |
Μοριακή δομή |
|
Πυκνότητα |
1.549g/cm3 |
Σημείο τήξης |
69.4℃ |
Σημείο βρασμού |
295.7°C at 760 mmHg |
Δείκτης διάθλασης |
1.586 |
Σημείο ανάφλεξης |
137.9°C |
Σύμβολα επικινδυνότητας |
C:Corrosive;
|
Κινδύνου Κώδικες |
R34:Causes burns.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|