ChemNet > CAS > 218795-72-3 1,3-dichloro-2-(2-chloro-4-nitrophenoxy)benzene
218795-72-3 1,3-dichloro-2-(2-chloro-4-nitrophenoxy)benzene
| Ονομασία του προϊόντος |
1,3-dichloro-2-(2-chloro-4-nitrophenoxy)benzene |
| MF |
C12H6Cl3NO3 |
| Μοριακό βάρος |
318.5399 |
| InChI |
InChI=1/C12H6Cl3NO3/c13-8-2-1-3-9(14)12(8)19-11-5-4-7(16(17)18)6-10(11)15/h1-6H |
| CAS ΟΧΙ |
218795-72-3 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.533g/cm3 |
| Σημείο τήξης |
136℃ |
| Σημείο βρασμού |
347.8°C at 760 mmHg |
| Δείκτης διάθλασης |
1.63 |
| Σημείο ανάφλεξης |
164.1°C |
| Σύμβολα επικινδυνότητας |
 Xn:Harmful;
|
| Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
