ChemNet > CAS > 22282-58-2 2-Iodo-3-methylpyridine
22282-58-2 2-Iodo-3-methylpyridine
| Ονομασία του προϊόντος |
2-Iodo-3-methylpyridine |
| Συνώνυμα |
2-Iodo-3-picoline |
| MF |
C6H6IN |
| Μοριακό βάρος |
219.023 |
| InChI |
InChI=1/C6H6IN/c1-5-3-2-4-8-6(5)7/h2-4H,1H3 |
| CAS ΟΧΙ |
22282-58-2 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.81g/cm3 |
| Σημείο βρασμού |
237.412°C at 760 mmHg |
| Δείκτης διάθλασης |
1.612 |
| Σημείο ανάφλεξης |
97.384°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
