ChemNet > CAS > 22814-92-2 4-(4-Chlorophenyl)-thiosemicarbazide
22814-92-2 4-(4-Chlorophenyl)-thiosemicarbazide
Ονομασία του προϊόντος |
4-(4-Chlorophenyl)-thiosemicarbazide |
Συνώνυμα |
4-(4-Chlorophenyl)-3-thiosemicarbazide; N-(4-chlorophenyl)hydrazinecarbothioamide |
MF |
C7H8ClN3S |
Μοριακό βάρος |
201.6765 |
InChI |
InChI=1/C7H8ClN3S/c8-5-1-3-6(4-2-5)10-7(12)11-9/h1-4H,9H2,(H2,10,11,12) |
CAS ΟΧΙ |
22814-92-2 |
Μοριακή δομή |
|
Πυκνότητα |
1.458g/cm3 |
Σημείο βρασμού |
318.3°C at 760 mmHg |
Δείκτης διάθλασης |
1.729 |
Σημείο ανάφλεξης |
146.3°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R25:Toxic if swallowed.;
|
Περιγραφή της ασφάλειας |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|