ChemNet > CAS > 23583-21-3 Benzylaminopropionicacidethylester
23583-21-3 Benzylaminopropionicacidethylester
| Ονομασία του προϊόντος |
Benzylaminopropionicacidethylester |
| Συνώνυμα |
N-Benzyl-3-aminopropionic acid ethyl ester; N-Benzyl-beta-alanine ethyl ester; Bzl-beta-Ala-OEt~Ethyl 3-(benzylamino)propionate; ethyl N-benzyl-beta-alaninate; Ethyl 3-(Benzylamino)Propanoate |
| MF |
C12H17NO2 |
| Μοριακό βάρος |
207.2689 |
| InChI |
InChI=1/C12H17NO2/c1-2-15-12(14)8-9-13-10-11-6-4-3-5-7-11/h3-7,13H,2,8-10H2,1H3 |
| CAS ΟΧΙ |
23583-21-3 |
| EINECS |
245-759-0 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.033g/cm3 |
| Σημείο βρασμού |
307.2°C at 760 mmHg |
| Δείκτης διάθλασης |
1.507 |
| Σημείο ανάφλεξης |
139.6°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R36/38:Irritating to eyes and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
