ChemNet > CAS > 25117-74-2 4-Ethoxybenzonitrile
25117-74-2 4-Ethoxybenzonitrile
| Ονομασία του προϊόντος |
4-Ethoxybenzonitrile |
| Συνώνυμα |
4-Ethoxybenzoic acid nitrile; p-Ethoxybenzonitrile |
| MF |
C9H9NO |
| Μοριακό βάρος |
147.1739 |
| InChI |
InChI=1/C9H9NO/c1-2-11-9-5-3-8(7-10)4-6-9/h3-6H,2H2,1H3 |
| CAS ΟΧΙ |
25117-74-2 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.05g/cm3 |
| Σημείο βρασμού |
258°C at 760 mmHg |
| Δείκτης διάθλασης |
1.52 |
| Σημείο ανάφλεξης |
110.9°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Περιγραφή της ασφάλειας |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
