ChemNet > CAS > 312-21-0 4-(Trifluoromethylsulfonyl)benzonitrile
312-21-0 4-(Trifluoromethylsulfonyl)benzonitrile
| Ονομασία του προϊόντος |
4-(Trifluoromethylsulfonyl)benzonitrile |
| Συνώνυμα |
4-Cyanophenyl trifluoromethyl sulphone; 4-(Trifluoromethylsulphonyl)benzonitrile; 4-(Trifluoromethanesulfonyl)benzonitrile |
| MF |
C6H4FNO |
| Μοριακό βάρος |
125.1005 |
| InChI |
InChI=1/C6H4FNO/c7-5-2-1-3-8-6(5)4-9/h1-4H |
| CAS ΟΧΙ |
312-21-0 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.269g/cm3 |
| Σημείο τήξης |
84-88℃ |
| Σημείο βρασμού |
166.5°C at 760 mmHg |
| Δείκτης διάθλασης |
1.543 |
| Σημείο ανάφλεξης |
54.5°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
