ChemNet > CAS > 32556-70-0 (R)-1-Octyn-3-ol
32556-70-0 (R)-1-Octyn-3-ol
| Ονομασία του προϊόντος |
(R)-1-Octyn-3-ol |
| Συνώνυμα |
(R)-(+)-1-Octyn-3-ol; (3R)-oct-1-yn-3-ol |
| MF |
C8H14O |
| Μοριακό βάρος |
126.1962 |
| InChI |
InChI=1/C8H14O/c1-3-5-6-7-8(9)4-2/h2,8-9H,3,5-7H2,1H3/t8-/m0/s1 |
| CAS ΟΧΙ |
32556-70-0 |
| Μοριακή δομή |
|
| Πυκνότητα |
0.887g/cm3 |
| Σημείο βρασμού |
169.6°C at 760 mmHg |
| Δείκτης διάθλασης |
1.452 |
| Σημείο ανάφλεξης |
63.9°C |
| Σύμβολα επικινδυνότητας |
 Xi:Irritant;
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
