ChemNet > CAS > 33018-91-6 Monoethylpimelate
33018-91-6 Monoethylpimelate
Ονομασία του προϊόντος |
Monoethylpimelate |
Συνώνυμα |
Ethyl hydrogen pimelate; Heptanedioic acid monoethyl ester; Monoethyl pimelate; Pimelic acid monoethyl ester; Ethylhydrogenpimelate; Pimelicacidmonoethylester; 7-ethoxy-7-oxoheptanoic acid; Boc-His(Tos)-Merrifield resin |
MF |
C9H16O4 |
Μοριακό βάρος |
188.2209 |
InChI |
InChI=1/C9H16O4/c1-2-13-9(12)7-5-3-4-6-8(10)11/h2-7H2,1H3,(H,10,11) |
CAS ΟΧΙ |
33018-91-6 |
EINECS |
251-346-6 |
Μοριακή δομή |
|
Πυκνότητα |
1.074g/cm3 |
Σημείο βρασμού |
288.7°C at 760 mmHg |
Δείκτης διάθλασης |
1.449 |
Σημείο ανάφλεξης |
108°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R36/38:Irritating to eyes and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|