ChemNet > CAS > 33143-29-2 2,2-dimethyl-2H-chromene-6-carbonitrile
33143-29-2 2,2-dimethyl-2H-chromene-6-carbonitrile
| Ονομασία του προϊόντος |
2,2-dimethyl-2H-chromene-6-carbonitrile |
| Συνώνυμα |
2,2-Dimethyl-2H-chromeme-6-carbonitrile |
| MF |
C12H11NO |
| Μοριακό βάρος |
185.2218 |
| InChI |
InChI=1/C12H11NO/c1-12(2)6-5-10-7-9(8-13)3-4-11(10)14-12/h3-7H,1-2H3 |
| CAS ΟΧΙ |
33143-29-2 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.13g/cm3 |
| Σημείο τήξης |
48℃ |
| Σημείο βρασμού |
301°C at 760 mmHg |
| Δείκτης διάθλασης |
1.578 |
| Σημείο ανάφλεξης |
126.8°C |
| Σύμβολα επικινδυνότητας |
 Xn:Harmful;
|
| Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Περιγραφή της ασφάλειας |
S36/37:Wear suitable protective clothing and gloves.;
|
|
