ChemNet > CAS > 33901-44-9 4-Methylphenoxyacetonitrile
33901-44-9 4-Methylphenoxyacetonitrile
| Ονομασία του προϊόντος |
4-Methylphenoxyacetonitrile |
| MF |
C9H9NO |
| Μοριακό βάρος |
147.1739 |
| InChI |
InChI=1/C9H9NO/c1-8-2-4-9(5-3-8)11-7-6-10/h2-5H,7H2,1H3 |
| CAS ΟΧΙ |
33901-44-9 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.054g/cm3 |
| Σημείο βρασμού |
262.5°C at 760 mmHg |
| Δείκτης διάθλασης |
1.517 |
| Σημείο ανάφλεξης |
109.8°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Περιγραφή της ασφάλειας |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
