ChemNet > CAS > 349-01-9 2,4-dinitro-5-fluorotoluene
349-01-9 2,4-dinitro-5-fluorotoluene
| Ονομασία του προϊόντος |
2,4-dinitro-5-fluorotoluene |
| Συνώνυμα |
1-Fluoro-5-methyl-2,4-dinitrobenzene |
| MF |
C7H5FN2O4 |
| Μοριακό βάρος |
200.124 |
| InChI |
InChI=1/C7H5FN2O4/c1-4-2-5(8)7(10(13)14)3-6(4)9(11)12/h2-3H,1H3 |
| CAS ΟΧΙ |
349-01-9 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.497g/cm3 |
| Σημείο τήξης |
82℃ |
| Σημείο βρασμού |
319°C at 760 mmHg |
| Δείκτης διάθλασης |
1.575 |
| Σημείο ανάφλεξης |
146.8°C |
| Σύμβολα επικινδυνότητας |
 T:Toxic;
|
| Κινδύνου Κώδικες |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| Περιγραφή της ασφάλειας |
S28A:After contact with skin, wash immediately with plenty of water.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S38:In case of insufficient ventilation, wear suitable respiratory equipment.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
