ChemNet > CAS > 3508-94-9 alpha-Isopropylphenylacetic acid
3508-94-9 alpha-Isopropylphenylacetic acid
| Ονομασία του προϊόντος |
alpha-Isopropylphenylacetic acid |
| Συνώνυμα |
3-Methyl-2-phenylbutyric acid; 3-methyl-2-phenylbutanoic acid; (2S)-3-methyl-2-phenylbutanoate |
| MF |
C11H13O2 |
| Μοριακό βάρος |
177.2203 |
| InChI |
InChI=1/C11H14O2/c1-8(2)10(11(12)13)9-6-4-3-5-7-9/h3-8,10H,1-2H3,(H,12,13)/p-1/t10-/m0/s1 |
| CAS ΟΧΙ |
3508-94-9 |
| Μοριακή δομή |
|
| Σημείο βρασμού |
282°C at 760 mmHg |
| Σημείο ανάφλεξης |
179.2°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
