ChemNet > CAS > 352018-92-9 5-iodo-2-phenoxypyridine
352018-92-9 5-iodo-2-phenoxypyridine
| Ονομασία του προϊόντος |
5-iodo-2-phenoxypyridine |
| MF |
C11H8INO |
| Μοριακό βάρος |
297.0918 |
| InChI |
InChI=1/C11H8INO/c12-9-6-7-11(13-8-9)14-10-4-2-1-3-5-10/h1-8H |
| CAS ΟΧΙ |
352018-92-9 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.694g/cm3 |
| Σημείο βρασμού |
339.8°C at 760 mmHg |
| Δείκτης διάθλασης |
1.646 |
| Σημείο ανάφλεξης |
159.3°C |
| Σύμβολα επικινδυνότητας |
 Xn:Harmful;
|
| Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Περιγραφή της ασφάλειας |
S36/37:Wear suitable protective clothing and gloves.;
|
|
