ChemNet > CAS > 355022-17-2 4-(isopropylamino)-3-nitrobenzonitrile
355022-17-2 4-(isopropylamino)-3-nitrobenzonitrile
Ονομασία του προϊόντος |
4-(isopropylamino)-3-nitrobenzonitrile |
Συνώνυμα |
4-[(1-methylethyl)amino]-3-nitrobenzonitrile |
MF |
C10H11N3O2 |
Μοριακό βάρος |
205.2132 |
InChI |
InChI=1/C10H11N3O2/c1-7(2)12-9-4-3-8(6-11)5-10(9)13(14)15/h3-5,7,12H,1-2H3 |
CAS ΟΧΙ |
355022-17-2 |
Μοριακή δομή |
|
Πυκνότητα |
1.21g/cm3 |
Σημείο τήξης |
113℃ |
Σημείο βρασμού |
347.4°C at 760 mmHg |
Δείκτης διάθλασης |
1.56 |
Σημείο ανάφλεξης |
163.9°C |
Σύμβολα επικινδυνότητας |
Xn:Harmful;
|
Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Περιγραφή της ασφάλειας |
S36/37:Wear suitable protective clothing and gloves.;
|
|