ChemNet > CAS > 3612-16-6 1-Ethyl-3-methyl-4-piperidone
3612-16-6 1-Ethyl-3-methyl-4-piperidone
Ονομασία του προϊόντος |
1-Ethyl-3-methyl-4-piperidone |
Συνώνυμα |
1-ethyl-3-methylpiperidin-4-one |
MF |
C8H15NO |
Μοριακό βάρος |
141.2108 |
InChI |
InChI=1/C8H15NO/c1-3-9-5-4-8(10)7(2)6-9/h7H,3-6H2,1-2H3 |
CAS ΟΧΙ |
3612-16-6 |
Μοριακή δομή |
|
Πυκνότητα |
0.931g/cm3 |
Σημείο βρασμού |
212.3°C at 760 mmHg |
Δείκτης διάθλασης |
1.45 |
Σημείο ανάφλεξης |
76.2°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|