ChemNet > CAS > 364-77-2 4-Fluoro-1-iodo-2-nitrobenzene
364-77-2 4-Fluoro-1-iodo-2-nitrobenzene
Ονομασία του προϊόντος |
4-Fluoro-1-iodo-2-nitrobenzene |
Συνώνυμα |
2-Iodo-5-fluoronitrobenzene; 5-fluoro-2-iodonitrobenzene; 4-Fluoro-2-Nitroiodobenzene |
MF |
C6H5FN2O2 |
Μοριακό βάρος |
156.1145 |
InChI |
InChI=1/C6H5FN2O2/c7-4-1-2-5(8)6(3-4)9(10)11/h1-3H,8H2 |
CAS ΟΧΙ |
364-77-2 |
EINECS |
206-666-0 |
Μοριακή δομή |
|
Πυκνότητα |
1.448g/cm3 |
Σημείο βρασμού |
295.1°C at 760 mmHg |
Δείκτης διάθλασης |
1.603 |
Σημείο ανάφλεξης |
89.4°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|