ChemNet > CAS > 374537-97-0 2-Amino-5-bromo-3,4-dimethylpyridine
374537-97-0 2-Amino-5-bromo-3,4-dimethylpyridine
| Ονομασία του προϊόντος |
2-Amino-5-bromo-3,4-dimethylpyridine |
| Συνώνυμα |
5-Bromo-3,4-dimethyl-2-pyridinamine; 5-bromo-3,4-dimethylpyridin-2-amine |
| MF |
C7H9BrN2 |
| Μοριακό βάρος |
201.0638 |
| InChI |
InChI=1/C7H9BrN2/c1-4-5(2)7(9)10-3-6(4)8/h3H,1-2H3,(H2,9,10) |
| CAS ΟΧΙ |
374537-97-0 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.504g/cm3 |
| Σημείο βρασμού |
278.2°C at 760 mmHg |
| Δείκτης διάθλασης |
1.603 |
| Σημείο ανάφλεξης |
122°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
