ChemNet > CAS > 3857-25-8 5-Methyl-2-furanmethanol
3857-25-8 5-Methyl-2-furanmethanol
| Ονομασία του προϊόντος |
5-Methyl-2-furanmethanol |
| Συνώνυμα |
(5-Methyl-2-furyl)methanol; (5-methylfuran-2-yl)methanol |
| MF |
C6H8O2 |
| Μοριακό βάρος |
112.1265 |
| InChI |
InChI=1/C6H8O2/c1-5-2-3-6(4-7)8-5/h2-3,7H,4H2,1H3 |
| CAS ΟΧΙ |
3857-25-8 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.095g/cm3 |
| Σημείο βρασμού |
178.5°C at 760 mmHg |
| Δείκτης διάθλασης |
1.494 |
| Σημείο ανάφλεξης |
61.8°C |
| Σύμβολα επικινδυνότητας |
 Xn:Harmful;
|
| Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Περιγραφή της ασφάλειας |
S36/37:Wear suitable protective clothing and gloves.;
|
|
