ChemNet > CAS > 3857-25-8 5-Methyl-2-furanmethanol
3857-25-8 5-Methyl-2-furanmethanol
Ονομασία του προϊόντος |
5-Methyl-2-furanmethanol |
Συνώνυμα |
(5-Methyl-2-furyl)methanol; (5-methylfuran-2-yl)methanol |
MF |
C6H8O2 |
Μοριακό βάρος |
112.1265 |
InChI |
InChI=1/C6H8O2/c1-5-2-3-6(4-7)8-5/h2-3,7H,4H2,1H3 |
CAS ΟΧΙ |
3857-25-8 |
Μοριακή δομή |
|
Πυκνότητα |
1.095g/cm3 |
Σημείο βρασμού |
178.5°C at 760 mmHg |
Δείκτης διάθλασης |
1.494 |
Σημείο ανάφλεξης |
61.8°C |
Σύμβολα επικινδυνότητας |
Xn:Harmful;
|
Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Περιγραφή της ασφάλειας |
S36/37:Wear suitable protective clothing and gloves.;
|
|