ChemNet > CAS > 3964-57-6 Methyl 3-chloro-4-hydroxybenzoate
3964-57-6 Methyl 3-chloro-4-hydroxybenzoate
| Ονομασία του προϊόντος |
Methyl 3-chloro-4-hydroxybenzoate |
| Συνώνυμα |
3-Chloro-4-hydroxybenzoic acid methyl ester; Methyl 3-chloro-4-hydroxy benzoate |
| MF |
C8H7ClO3 |
| Μοριακό βάρος |
186.5924 |
| InChI |
InChI=1/C8H7ClO3/c1-12-8(11)5-2-3-7(10)6(9)4-5/h2-4,10H,1H3 |
| CAS ΟΧΙ |
3964-57-6 |
| EINECS |
223-573-0 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.354g/cm3 |
| Σημείο τήξης |
106-107℃ |
| Σημείο βρασμού |
284.9°C at 760 mmHg |
| Δείκτης διάθλασης |
1.564 |
| Σημείο ανάφλεξης |
126.1°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
