ChemNet > CAS > 40477-45-0 3,4-Dibromo-2,5-dichlorothiophene
40477-45-0 3,4-Dibromo-2,5-dichlorothiophene
| Ονομασία του προϊόντος |
3,4-Dibromo-2,5-dichlorothiophene |
| MF |
C4Br2Cl2S |
| Μοριακό βάρος |
310.8218 |
| InChI |
InChI=1/C4Br2Cl2S/c5-1-2(6)4(8)9-3(1)7 |
| CAS ΟΧΙ |
40477-45-0 |
| Μοριακή δομή |
|
| Πυκνότητα |
2.299g/cm3 |
| Σημείο βρασμού |
284.1°C at 760 mmHg |
| Δείκτης διάθλασης |
1.658 |
| Σημείο ανάφλεξης |
125.6°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Περιγραφή της ασφάλειας |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
