ChemNet > CAS > 41200-96-8 2,4-Dichloro-5-isopropoxyaniline
41200-96-8 2,4-Dichloro-5-isopropoxyaniline
Ονομασία του προϊόντος |
2,4-Dichloro-5-isopropoxyaniline |
Συνώνυμα |
2,4-dichloro-5-(propan-2-yloxy)aniline |
MF |
C9H11Cl2NO |
Μοριακό βάρος |
220.0957 |
InChI |
InChI=1/C9H11Cl2NO/c1-5(2)13-9-4-8(12)6(10)3-7(9)11/h3-5H,12H2,1-2H3 |
CAS ΟΧΙ |
41200-96-8 |
EINECS |
255-258-9 |
Μοριακή δομή |
|
Πυκνότητα |
1.272g/cm3 |
Σημείο βρασμού |
310.8°C at 760 mmHg |
Δείκτης διάθλασης |
1.562 |
Σημείο ανάφλεξης |
141.8°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Περιγραφή της ασφάλειας |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|