CAS No: 41411-61-4;26601-64-9, Chemical Name: 2,2',3,4,5,6-hexachlorobiphenyl
the physical and chemical property of 41411-61-4;26601-64-9, 2,2',3,4,5,6-hexachlorobiphenyl is provided by ChemNet.com
ChemNet > CAS > 41411-61-4;26601-64-9 2,2',3,4,5,6-hexachlorobiphenyl
41411-61-4;26601-64-9 2,2',3,4,5,6-hexachlorobiphenyl
Ονομασία του προϊόντος |
2,2',3,4,5,6-hexachlorobiphenyl |
Συνώνυμα |
1,1'-biphenyl, 2,2',3,4,5,6-hexachloro-; 2,2',3,4,5,6-Hexachloro-1,1'-biphenyl; 2,2',3,4,5,6-PCB; 41411-61-4 |
MF |
C12H4Cl6 |
Μοριακό βάρος |
360.8782 |
InChI |
InChI=1/C12H4Cl6/c13-6-4-2-1-3-5(6)7-8(14)10(16)12(18)11(17)9(7)15/h1-4H |
CAS ΟΧΙ |
41411-61-4;26601-64-9 |
Μοριακή δομή |
|
Πυκνότητα |
1.593g/cm3 |
Σημείο βρασμού |
383.8°C at 760 mmHg |
Δείκτης διάθλασης |
1.626 |
Σημείο ανάφλεξης |
184°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
|
Περιγραφή της ασφάλειας |
|
|