ChemNet > CAS > 41963-20-6 4-Bromo-3-methylbenzonitrile
41963-20-6 4-Bromo-3-methylbenzonitrile
| Ονομασία του προϊόντος |
4-Bromo-3-methylbenzonitrile |
| Συνώνυμα |
4-Bromo-m-tolunitrile (CN=1); 3-Methyl-4-bromobenzonitrile |
| MF |
C8H6BrN |
| Μοριακό βάρος |
196.0439 |
| InChI |
InChI=1/C8H6BrN/c1-6-4-7(5-10)2-3-8(6)9/h2-4H,1H3 |
| CAS ΟΧΙ |
41963-20-6 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.51g/cm3 |
| Σημείο βρασμού |
265°C at 760 mmHg |
| Δείκτης διάθλασης |
1.59 |
| Σημείο ανάφλεξης |
114.1°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Περιγραφή της ασφάλειας |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
