ChemNet > CAS > 4320-30-3 L-arginine L-glutamate
4320-30-3 L-arginine L-glutamate
Ονομασία του προϊόντος |
L-arginine L-glutamate |
Συνώνυμα |
argimate; arginine glutamate; arginine, glutamate, L-; Arginine l-glutamate; ginamate; glutamic acid compd with L-arginine; glutargin; glutepar; L-Arginine L-glutamate (1:1); L-arginyl-L-glutamate; L-glutamic acid, compd. with L-arginine; modumate; N~5~-(diaminomethylidene)ornithine-glutamic acid (1:1); N~5~-(diaminomethylidene)-L-ornithine-L-glutamic acid (1:1); L-Arg L-Glu |
MF |
C11H23N5O6 |
Μοριακό βάρος |
321.3302 |
InChI |
InChI=1/C6H14N4O2.C5H9NO4/c7-4(5(11)12)2-1-3-10-6(8)9;6-3(5(9)10)1-2-4(7)8/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);3H,1-2,6H2,(H,7,8)(H,9,10)/t4-;3-/m00/s1 |
CAS ΟΧΙ |
4320-30-3 |
EINECS |
224-350-0 |
Μοριακή δομή |
|
Σημείο βρασμού |
409.1°C at 760 mmHg |
Σημείο ανάφλεξης |
201.2°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
|
Περιγραφή της ασφάλειας |
|
|