ChemNet > CAS > 4395-87-3 4-Isopropylphenylacetonitrile
4395-87-3 4-Isopropylphenylacetonitrile
Ονομασία του προϊόντος |
4-Isopropylphenylacetonitrile |
Συνώνυμα |
[4-(propan-2-yl)phenyl]acetonitrile |
MF |
C11H13N |
Μοριακό βάρος |
159.2276 |
InChI |
InChI=1/C11H13N/c1-9(2)11-5-3-10(4-6-11)7-8-12/h3-6,9H,7H2,1-2H3 |
CAS ΟΧΙ |
4395-87-3 |
Μοριακή δομή |
|
Πυκνότητα |
0.96g/cm3 |
Σημείο βρασμού |
261.1°C at 760 mmHg |
Δείκτης διάθλασης |
1.514 |
Σημείο ανάφλεξης |
117.5°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Περιγραφή της ασφάλειας |
S36/37:Wear suitable protective clothing and gloves.;
|
|