ChemNet > CAS > 4463-33-6 2,3-Dimethoxytoluene
4463-33-6 2,3-Dimethoxytoluene
| Ονομασία του προϊόντος |
2,3-Dimethoxytoluene |
| Συνώνυμα |
3-Methylveratrole; 1,2-dimethoxy-3-methylbenzene |
| MF |
C9H12O2 |
| Μοριακό βάρος |
152.1904 |
| InChI |
InChI=1/C9H12O2/c1-7-5-4-6-8(10-2)9(7)11-3/h4-6H,1-3H3 |
| CAS ΟΧΙ |
4463-33-6 |
| EINECS |
224-726-4 |
| Μοριακή δομή |
|
| Πυκνότητα |
0.99g/cm3 |
| Σημείο βρασμού |
201.4°C at 760 mmHg |
| Δείκτης διάθλασης |
1.489 |
| Σημείο ανάφλεξης |
67.6°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R36/38:Irritating to eyes and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
