ChemNet > CAS > 455-67-4 3-fluoropropiophenone
455-67-4 3-fluoropropiophenone
| Ονομασία του προϊόντος |
3-fluoropropiophenone |
| Συνώνυμα |
3'-FLUOROPROPIOPHENONE; 1-(3-fluorophenyl)propan-1-one |
| MF |
C9H9FO |
| Μοριακό βάρος |
152.1656 |
| InChI |
InChI=1/C9H9FO/c1-2-9(11)7-4-3-5-8(10)6-7/h3-6H,2H2,1H3 |
| CAS ΟΧΙ |
455-67-4 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.074g/cm3 |
| Σημείο βρασμού |
209.8°C at 760 mmHg |
| Δείκτης διάθλασης |
1.489 |
| Σημείο ανάφλεξης |
79.8°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R36/38:Irritating to eyes and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
