ChemNet > CAS > 4593-90-2 (+/-)-3-phenylbutyric acid
4593-90-2 (+/-)-3-phenylbutyric acid
Ονομασία του προϊόντος |
(+/-)-3-phenylbutyric acid |
Συνώνυμα |
3-Phenylbutyric acid; 3-phenylbutanoic acid |
MF |
C10H12O2 |
Μοριακό βάρος |
164.2011 |
InChI |
InChI=1/C10H12O2/c1-8(7-10(11)12)9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,11,12) |
CAS ΟΧΙ |
4593-90-2 |
EINECS |
224-987-4 |
Μοριακή δομή |
|
Πυκνότητα |
1.09g/cm3 |
Σημείο τήξης |
35-38℃ |
Σημείο βρασμού |
288°C at 760 mmHg |
Δείκτης διάθλασης |
1.531 |
Σημείο ανάφλεξης |
170.2°C |
Σύμβολα επικινδυνότητας |
|
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|