ChemNet > CAS > 4593-90-2 (+/-)-3-phenylbutyric acid
4593-90-2 (+/-)-3-phenylbutyric acid
| Ονομασία του προϊόντος |
(+/-)-3-phenylbutyric acid |
| Συνώνυμα |
3-Phenylbutyric acid; 3-phenylbutanoic acid |
| MF |
C10H12O2 |
| Μοριακό βάρος |
164.2011 |
| InChI |
InChI=1/C10H12O2/c1-8(7-10(11)12)9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,11,12) |
| CAS ΟΧΙ |
4593-90-2 |
| EINECS |
224-987-4 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.09g/cm3 |
| Σημείο τήξης |
35-38℃ |
| Σημείο βρασμού |
288°C at 760 mmHg |
| Δείκτης διάθλασης |
1.531 |
| Σημείο ανάφλεξης |
170.2°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
