ChemNet > CAS > 4755-50-4 4-Dimethylaminobenzoylchloride
4755-50-4 4-Dimethylaminobenzoylchloride
| Ονομασία του προϊόντος |
4-Dimethylaminobenzoylchloride |
| Συνώνυμα |
4-Dimethylaminobenzoyl chloride; 4-(ethylamino)benzoyl chloride |
| MF |
C9H10ClNO |
| Μοριακό βάρος |
183.6348 |
| InChI |
InChI=1/C9H10ClNO/c1-11(2)8-5-3-7(4-6-8)9(10)12/h3-6H,1-2H3 |
| CAS ΟΧΙ |
4755-50-4 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.193g/cm3 |
| Σημείο βρασμού |
279°C at 760 mmHg |
| Δείκτης διάθλασης |
1.574 |
| Σημείο ανάφλεξης |
122.5°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R34:Causes burns.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
