ChemNet > CAS > 4815-30-9 Diethyl 5-amino-3-methyl-2,4-thiophenedicarboxylate
4815-30-9 Diethyl 5-amino-3-methyl-2,4-thiophenedicarboxylate
| Ονομασία του προϊόντος |
Diethyl 5-amino-3-methyl-2,4-thiophenedicarboxylate |
| Συνώνυμα |
5-Amino-3-methyl-2,4-thiophenedicarboxilic acid diethyl ester; diethyl 5-amino-3-methylthiophene-2,4-dicarboxylate |
| MF |
C11H15NO4S |
| Μοριακό βάρος |
257.3061 |
| InChI |
InChI=1/C11H15NO4S/c1-4-15-10(13)7-6(3)8(17-9(7)12)11(14)16-5-2/h4-5,12H2,1-3H3 |
| CAS ΟΧΙ |
4815-30-9 |
| EINECS |
225-388-0 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.247g/cm3 |
| Σημείο τήξης |
103-108℃ |
| Σημείο βρασμού |
372.6°C at 760 mmHg |
| Δείκτης διάθλασης |
1.558 |
| Σημείο ανάφλεξης |
179.1°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
|
| Περιγραφή της ασφάλειας |
S24/25:Avoid contact with skin and eyes.;
|
|
