ChemNet > CAS > 488-87-9 2,5-Dimethylresorcinol
488-87-9 2,5-Dimethylresorcinol
| Ονομασία του προϊόντος |
2,5-Dimethylresorcinol |
| Συνώνυμα |
2,5-dimethylbenzene-1,3-diol |
| MF |
C8H10O2 |
| Μοριακό βάρος |
138.1638 |
| InChI |
InChI=1/C8H10O2/c1-5-3-7(9)6(2)8(10)4-5/h3-4,9-10H,1-2H3 |
| CAS ΟΧΙ |
488-87-9 |
| EINECS |
207-688-3 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.162g/cm3 |
| Σημείο τήξης |
161℃ |
| Σημείο βρασμού |
284.1°C at 760 mmHg |
| Δείκτης διάθλασης |
1.582 |
| Σημείο ανάφλεξης |
140.8°C |
| Σύμβολα επικινδυνότητας |
 Xn:Harmful;
|
| Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
