ChemNet > CAS > 4906-24-5 3-Acetoxy-2-butanone
4906-24-5 3-Acetoxy-2-butanone
| Ονομασία του προϊόντος |
3-Acetoxy-2-butanone |
| Συνώνυμα |
Acetoin acetate; 3-oxobutan-2-yl acetate; 2-Acetoxy-3-butanone |
| MF |
C6H10O3 |
| Μοριακό βάρος |
130.1418 |
| InChI |
InChI=1/C6H10O3/c1-4(7)5(2)9-6(3)8/h5H,1-3H3 |
| CAS ΟΧΙ |
4906-24-5 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.012g/cm3 |
| Σημείο βρασμού |
163.4°C at 760 mmHg |
| Δείκτης διάθλασης |
1.406 |
| Σημείο ανάφλεξης |
56.6°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
R36/38:Irritating to eyes and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
