ChemNet > CAS > 51067-38-0 4-Phenoxyphenyl boronic acid
51067-38-0 4-Phenoxyphenyl boronic acid
| Ονομασία του προϊόντος |
4-Phenoxyphenyl boronic acid |
| Συνώνυμα |
4-Phenoxybenzene boronic acid;
|
| MF |
C12H11BO3 |
| Μοριακό βάρος |
214.0249 |
| InChI |
InChI=1/C12H11BO3/c14-13(15)10-6-8-12(9-7-10)16-11-4-2-1-3-5-11/h1-9,14-15H |
| CAS ΟΧΙ |
51067-38-0 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.23g/cm3 |
| Σημείο τήξης |
141-145℃ |
| Σημείο βρασμού |
377°C at 760 mmHg |
| Δείκτης διάθλασης |
1.605 |
| Σημείο ανάφλεξης |
181.8°C |
| Σύμβολα επικινδυνότητας |
 Xi:Irritant;
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
