ChemNet > CAS > 5117-88-4 2-amino-4,5-dimethyl-3-furancarbonitrile
5117-88-4 2-amino-4,5-dimethyl-3-furancarbonitrile
| Ονομασία του προϊόντος |
2-amino-4,5-dimethyl-3-furancarbonitrile |
| Συνώνυμα |
2-Amino-4,5-dimethyl-3-furonitrile; 2-amino-4,5-dimethylfuran-3-carbonitrile |
| MF |
C7H8N2O |
| Μοριακό βάρος |
136.1512 |
| InChI |
InChI=1/C7H8N2O/c1-4-5(2)10-7(9)6(4)3-8/h9H2,1-2H3 |
| CAS ΟΧΙ |
5117-88-4 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.15g/cm3 |
| Σημείο τήξης |
163-169℃ |
| Σημείο βρασμού |
287.8°C at 760 mmHg |
| Δείκτης διάθλασης |
1.535 |
| Σημείο ανάφλεξης |
127.8°C |
| Σύμβολα επικινδυνότητας |
 Xn:Harmful;
|
| Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Περιγραφή της ασφάλειας |
S36/37:Wear suitable protective clothing and gloves.;
|
|
